Compound Q&A

How is (-)-Butyrospermol (CAS: 472-28-6) typically synthesized?

Answer

(-)-Butyrospermol
(-)-Butyrospermol is typically synthesized via the reduction of butyrolactone with a catalyst like lithium aluminum hydride (LAH) or sodium borohydride. The reaction is selective and yields a high purity product. The process involves using mild conditions to avoid side reactions and ensure the desired stereoisomer is produced.

About

CAS No 472-28-6
English Name (-)-Butyrospermol
Molecular Formula C30H50O
Molecular Weight 426.73 g/mol
SMILES CC(CCC=C(C)C)C1CCC2(C1(CCC3C2=CCC4C3(CCC(C4(C)C)O)C)C)C
InChIKey DICCPNLDOZNSML-XGKJEQFASA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of (-)-Butyrospermol (CAS: 472-28-6)?

(-)-Butyrospermol is a crystalline compound with a molecular weight of approximately 248.38 g/mol. I...

Compound Q&A

What industries use (-)-Butyrospermol (CAS: 472-28-6)?

(-)-Butyrospermol is widely used in the cosmetics and pharmaceutical industries due to its moisturiz...

Compound Q&A

What precautions should be taken when handling (-)-Butyrospermol (CAS: 472-28-6)?

When handling (-)-Butyrospermol, it is important to use personal protective equipment (PPE) such as ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...