Compound Q&A

What industries use 2-Methyl-2-propanyl 3-cyclopropyl-3-hydroxy-1-azetidinecarboxylate (CAS: 1438858-75-3)?

Answer

2-Methyl-2-propanyl 3-cyclopropyl-3-hydroxy-1-azetidinecarboxylate
2-Methyl-2-propanyl 3-cyclopropyl-3-hydroxy-1-azetidinecarboxylate is primarily used in the pharmaceutical industry for the development of new drugs. It also finds applications in the polymer industry as a monomer for the synthesis of novel materials with specific properties. Additionally, it is utilized in the production of chemical sensors and semiconductors.

About

English Name 2-Methyl-2-propanyl 3-cyclopropyl-3-hydroxy-1-azetidinecarboxylate
Molecular Formula C11H19NO3
Molecular Weight 213.27699999999996 g/mol
SMILES CC(C)(C)OC(=O)N1CC(O)(C1)C2CC2
InChIKey BEQDEDUMJIZSHF-UHFFFAOYSA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3-cyclopropyl-3-hydroxy-1-azetidinecarboxylate (CAS: 1438858-75-3)?

2-Methyl-2-propanyl 3-cyclopropyl-3-hydroxy-1-azetidinecarboxylate is a crystalline solid with a mol...

Compound Q&A

How is 2-Methyl-2-propanyl 3-cyclopropyl-3-hydroxy-1-azetidinecarboxylate (CAS: 1438858-75-3) typically synthesized?

2-Methyl-2-propanyl 3-cyclopropyl-3-hydroxy-1-azetidinecarboxylate is typically synthesized via amid...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 3-cyclopropyl-3-hydroxy-1-azetidinecarboxylate (CAS: 1438858-75-3)?

When handling 2-Methyl-2-propanyl 3-cyclopropyl-3-hydroxy-1-azetidinecarboxylate, it is essential to...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...