Compound Q&A

What industries use 2-Methyl-2-propanyl 3-cyclopropyl-3-hydroxy-1-azetidinecarboxylate (CAS: 1438858-75-3)?

Answer

2-Methyl-2-propanyl 3-cyclopropyl-3-hydroxy-1-azetidinecarboxylate
2-Methyl-2-propanyl 3-cyclopropyl-3-hydroxy-1-azetidinecarboxylate is primarily used in the pharmaceutical industry for the development of new drugs. It also finds applications in the polymer industry as a monomer for the synthesis of novel materials with specific properties. Additionally, it is utilized in the production of chemical sensors and semiconductors.

About

English Name 2-Methyl-2-propanyl 3-cyclopropyl-3-hydroxy-1-azetidinecarboxylate
Molecular Formula C11H19NO3
Molecular Weight 213.28 g/mol
SMILES CC(C)(C)OC(=O)N1CC(O)(C1)C2CC2
InChIKey BEQDEDUMJIZSHF-UHFFFAOYSA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3-cyclopropyl-3-hydroxy-1-azetidinecarboxylate (CAS: 1438858-75-3)?

2-Methyl-2-propanyl 3-cyclopropyl-3-hydroxy-1-azetidinecarboxylate is a crystalline solid with a mol...

Compound Q&A

How is 2-Methyl-2-propanyl 3-cyclopropyl-3-hydroxy-1-azetidinecarboxylate (CAS: 1438858-75-3) typically synthesized?

2-Methyl-2-propanyl 3-cyclopropyl-3-hydroxy-1-azetidinecarboxylate is typically synthesized via amid...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 3-cyclopropyl-3-hydroxy-1-azetidinecarboxylate (CAS: 1438858-75-3)?

When handling 2-Methyl-2-propanyl 3-cyclopropyl-3-hydroxy-1-azetidinecarboxylate, it is essential to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...