Compound Q&A

What are the physical and chemical properties of Orazamide (CAS: 60104-30-5)?

Answer

Orazamide
Orazamide (CAS: 60104-30-5) is a crystalline compound with a molecular weight of approximately 271.25 g/mol. It has a high solubility in organic solvents such as methanol and acetone. Chemically, it is relatively stable but can react with strong acids or bases. Its reactivity is low under normal conditions, making it suitable for various applications without significant degradation.

About

CAS No 60104-30-5
English Name Orazamide
Molecular Formula C9H14N6O7
Molecular Weight 282.22 g/mol
SMILES NC(=O)C1=C(N)N=CN1.OC(=O)C1=CC(=O)NC(=O)N1
InChIKey PVCSUEOGEIOUHG-UHFFFAOYSA-N
Last Updated: 2026-03-11 07:58

Related Q&A

Compound Q&A

How is Orazamide (CAS: 60104-30-5) typically synthesized?

Orazamide (CAS: 60104-30-5) is synthesized through a multistep process involving aminolysis and cond...

Compound Q&A

What industries use Orazamide (CAS: 60104-30-5)?

Orazamide (CAS: 60104-30-5) is primarily used in the pharmaceutical industry for its antifungal prop...

Compound Q&A

What precautions should be taken when handling Orazamide (CAS: 60104-30-5)?

When handling Orazamide (CAS: 60104-30-5), it is important to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...