Compound Q&A

How is Argatroban Impurity 4 (CAS: 153886-68-1) typically synthesized?

Answer

Argatroban Impurity 4
Argatroban Impurity 4 is typically synthesized through a multi-step process involving amidation and acylation reactions. The synthesis involves the use of specific catalysts and solvents to achieve high selectivity and yield. The exact conditions and reagents vary depending on the specific methodology used.

About

English Name Argatroban Impurity 4
Molecular Formula C10H13NO3S
Molecular Weight 227.28 g/mol
SMILES CC1CNc2c(C1)cccc2S(=O)(=O)O
InChIKey HDGVSYYMMRPVBX-UHFFFAOYSA-N
Last Updated: 2026-03-11 07:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Argatroban Impurity 4 (CAS: 153886-68-1)?

Argatroban Impurity 4 (CAS: 153886-68-1) is a crystalline compound with a molecular weight of approx...

Compound Q&A

What industries use Argatroban Impurity 4 (CAS: 153886-68-1)?

Argatroban Impurity 4 (CAS: 153886-68-1) is primarily used in the pharmaceutical industry. It is a k...

Compound Q&A

What precautions should be taken when handling Argatroban Impurity 4 (CAS: 153886-68-1)?

When handling Argatroban Impurity 4 (CAS: 153886-68-1), it is essential to use appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...