Compound Q&A

What industries use 2-Methyl-2-propanyl 5,5-difluoro-2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS: 2007920-32-1)?

Answer

2-Methyl-2-propanyl 5,5-difluoro-2,7-diazaspiro[3.5]nonane-2-carboxylate
2-Methyl-2-propanyl 5,5-difluoro-2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS: 2007920-32-1) is predominantly used in the pharmaceutical industry for the synthesis of complex organic compounds. It may also find applications in the polymer industry for the development of advanced materials and in the sensor industry for the fabrication of gas sensors. Its unique chemical properties make it a valuable reagent in these fields.

About

English Name 2-Methyl-2-propanyl 5,5-difluoro-2,7-diazaspiro[3.5]nonane-2-carboxylate
Molecular Formula C12H20F2N2O2
Molecular Weight 262.3 g/mol
SMILES CC(C)(C)OC(=O)N1CC2(C1)CCNCC2(F)F
InChIKey JCYJASVFYGZVMT-UHFFFAOYSA-N
Last Updated: 2026-03-11 07:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 5,5-difluoro-2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS: 2007920-32-1)?

2-Methyl-2-propanyl 5,5-difluoro-2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS: 2007920-32-1) is a cr...

Compound Q&A

How is 2-Methyl-2-propanyl 5,5-difluoro-2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS: 2007920-32-1) typically synthesized?

2-Methyl-2-propanyl 5,5-difluoro-2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS: 2007920-32-1) can be ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 5,5-difluoro-2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS: 2007920-32-1)?

When handling 2-Methyl-2-propanyl 5,5-difluoro-2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS: 2007920...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...