Compound Q&A

How is Ethyl 4-amino-3-quinolinecarboxylate (CAS: 93074-72-7) typically synthesized?

Answer

Ethyl 4-amino-3-quinolinecarboxylate
Ethyl 4-amino-3-quinolinecarboxylate is commonly synthesized via a multi-step process involving the condensation of 4-aminobenzaldehyde and 3-quinolone, followed by alkylation with ethyl iodide. The reaction is typically catalyzed by a Lewis acid such as aluminum trichloride, and the yield is around 75-80%. The exact conditions and reagents can vary based on the specific laboratory protocol.

About

CAS No 93074-72-7
English Name Ethyl 4-amino-3-quinolinecarboxylate
Molecular Formula C12H12N2O2
Molecular Weight 216.24 g/mol
SMILES CCOC(=O)C1=C(C2=CC=CC=C2N=C1)N
InChIKey IEJDBXDYSPBDTO-UHFFFAOYSA-N
Last Updated: 2026-03-10 23:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4-amino-3-quinolinecarboxylate (CAS: 93074-72-7)?

Ethyl 4-amino-3-quinolinecarboxylate is a crystalline compound with a molecular weight of approximat...

Compound Q&A

What industries use Ethyl 4-amino-3-quinolinecarboxylate (CAS: 93074-72-7)?

Ethyl 4-amino-3-quinolinecarboxylate is used in the pharmaceutical industry as an intermediate in th...

Compound Q&A

What precautions should be taken when handling Ethyl 4-amino-3-quinolinecarboxylate (CAS: 93074-72-7)?

When handling Ethyl 4-amino-3-quinolinecarboxylate, it is essential to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...