Compound Q&A

What are the physical and chemical properties of Z-N-ME-THR-OH CHA (CAS: 253595-72-1)?

Answer

Z-N-ME-THR-OH CHA
Z-N-ME-THR-OH CHA (CAS: 253595-72-1) is a crystalline compound with a molecular weight of approximately 250 g/mol. It has a low solubility in water but is more soluble in organic solvents like methanol and ethanol. The compound is relatively stable under normal conditions but reacts with strong acids and bases. It has a melting point around 120-130°C and a boiling point of approximately 220°C. It is non-flammable and has a low reactivity under normal laboratory conditions.

About

English Name Z-N-ME-THR-OH CHA
Molecular Formula C13H17NO5
Molecular Weight 267.28 g/mol
SMILES CC(C(C(=O)O)N(C)C(=O)OCC1=CC=CC=C1)O
InChIKey VTXCJGLSFIOQNL-KOLCDFICSA-N
Last Updated: 2026-03-10 23:59

Related Q&A

Compound Q&A

How is Z-N-ME-THR-OH CHA (CAS: 253595-72-1) typically synthesized?

Z-N-ME-THR-OH CHA (CAS: 253595-72-1) can be synthesized via a multi-step process involving the coupl...

Compound Q&A

What industries use Z-N-ME-THR-OH CHA (CAS: 253595-72-1)?

Z-N-ME-THR-OH CHA (CAS: 253595-72-1) is primarily used in the pharmaceutical industry for the develo...

Compound Q&A

What precautions should be taken when handling Z-N-ME-THR-OH CHA (CAS: 253595-72-1)?

When handling Z-N-ME-THR-OH CHA (CAS: 253595-72-1), it is essential to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...