Compound Q&A

What industries use 2-Bromo-6-nitrobenzonitrile (CAS: 79603-02-4)?

Answer

2-Bromo-6-nitrobenzonitrile
2-Bromo-6-nitrobenzonitrile (CAS: 79603-02-4) is primarily used in the pharmaceutical industry as a precursor for the synthesis of various medicinal compounds. It also finds application in the polymer industry for the development of functional polymers and in analytical chemistry for the production of sensors and semiconductors.

About

CAS No 79603-02-4
English Name 2-Bromo-6-nitrobenzonitrile
Molecular Formula C7H3BrN2O2
Molecular Weight 227.01 g/mol
SMILES N#Cc1c(Br)cccc1[N+](=O)[O-]
InChIKey QGZKDVFQNNGYKY-UHFFFAOYSA-N
Last Updated: 2026-03-10 23:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-6-nitrobenzonitrile (CAS: 79603-02-4)?

2-Bromo-6-nitrobenzonitrile (CAS: 79603-02-4) is a crystalline solid with a molecular weight of 243....

Compound Q&A

How is 2-Bromo-6-nitrobenzonitrile (CAS: 79603-02-4) typically synthesized?

2-Bromo-6-nitrobenzonitrile can be synthesized via the reaction of 6-nitrobenzonitrile with N-bromos...

Compound Q&A

What precautions should be taken when handling 2-Bromo-6-nitrobenzonitrile (CAS: 79603-02-4)?

When handling 2-Bromo-6-nitrobenzonitrile (CAS: 79603-02-4), it is essential to wear personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...