Compound Q&A

What industries use 2-Methyl-2-propanyl {[1-(chloroacetyl)-4-piperidinyl]methyl}carbamate (CAS: 1353952-84-7)?

Answer

2-Methyl-2-propanyl {[1-(chloroacetyl)-4-piperidinyl]methyl}carbamate
This compound is primarily used in the pharmaceutical industry for its potential as a drug candidate. It is also explored in the polymer industry for its possible use in the synthesis of functional polymers. Additionally, it may have applications in the sensor and semiconductor industries, though its use in these fields is less common and more experimental.

About

English Name 2-Methyl-2-propanyl {[1-(chloroacetyl)-4-piperidinyl]methyl}carbamate
Molecular Formula C13H23ClN2O3
Molecular Weight 290.7863 g/mol
SMILES CC(C)(C)OC(=O)NCC1CCN(CC1)C(=O)CCl
InChIKey SUVQUXXXBLWSSK-UHFFFAOYSA-N
Last Updated: 2026-03-10 23:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl {[1-(chloroacetyl)-4-piperidinyl]methyl}carbamate (CAS: 1353952-84-7)?

This compound is a solid at room temperature with a crystalline form. Its molecular weight is approx...

Compound Q&A

How is 2-Methyl-2-propanyl {[1-(chloroacetyl)-4-piperidinyl]methyl}carbamate (CAS: 1353952-84-7) typically synthesized?

This compound is typically synthesized through a multi-step process involving the reaction of a pipe...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl {[1-(chloroacetyl)-4-piperidinyl]methyl}carbamate (CAS: 1353952-84-7)?

Proper Personal Protective Equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What regulatory guidelines apply to 4-Amino-3-bromophenol (CAS: 74440-80-5)?

4-Amino-3-bromophenol (CAS: 74440-80-5) falls under the classification of a haza...

74440-80-54-Amino-3-bromopheno...
Compound Q&A

How should (17beta)-3-Oxoestr-4-en-17-yl acetate (CAS: 1425-10-1) be stored?

(17beta)-3-Oxoestr-4-en-17-yl acetate should be stored in a cool, dry place away...

1425-10-1(17beta)-3-Oxoestr-4...
Compound Q&A

What are the physical and chemical properties of 2-[(2,2-Diethoxyethyl)disulfanyl]-1,1-diethoxyethane (CAS: 76505-71-0)?

2-[(2,2-Diethoxyethyl)disulfanyl]-1,1-diethoxyethane (CAS: 76505-71-0) is a colo...

76505-71-02-[(2,2-Diethoxyethy...
Compound Q&A

What is the market or research trend for 1-(β-D-ribofuranosyl)-1H-imidazo[4,5-c]pyridin-4-amine?

The market and research for 1-(β-D-ribofuranosyl)-1H-imidazo[4,5-c]pyridin-4-ami...

6736-58-91-(beta-D-Ribofurano...