Compound Q&A

How is 2-Methyl-2-propanyl {[1-(chloroacetyl)-4-piperidinyl]methyl}carbamate (CAS: 1353952-84-7) typically synthesized?

Answer

2-Methyl-2-propanyl {[1-(chloroacetyl)-4-piperidinyl]methyl}carbamate
This compound is typically synthesized through a multi-step process involving the reaction of a piperidine derivative with chloroacetyl chloride, followed by a coupling with 2-methyl-2-propanol. The reaction involves the use of a catalyst such as triethylamine to enhance the yield. The product is isolated by column chromatography. The process yields a high purity product with good selectivity and efficiency.

About

English Name 2-Methyl-2-propanyl {[1-(chloroacetyl)-4-piperidinyl]methyl}carbamate
Molecular Formula C13H23ClN2O3
Molecular Weight 290.7863 g/mol
SMILES CC(C)(C)OC(=O)NCC1CCN(CC1)C(=O)CCl
InChIKey SUVQUXXXBLWSSK-UHFFFAOYSA-N
Last Updated: 2026-03-10 23:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl {[1-(chloroacetyl)-4-piperidinyl]methyl}carbamate (CAS: 1353952-84-7)?

This compound is a solid at room temperature with a crystalline form. Its molecular weight is approx...

Compound Q&A

What industries use 2-Methyl-2-propanyl {[1-(chloroacetyl)-4-piperidinyl]methyl}carbamate (CAS: 1353952-84-7)?

This compound is primarily used in the pharmaceutical industry for its potential as a drug candidate...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl {[1-(chloroacetyl)-4-piperidinyl]methyl}carbamate (CAS: 1353952-84-7)?

Proper Personal Protective Equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What regulatory guidelines apply to 4-Amino-3-bromophenol (CAS: 74440-80-5)?

4-Amino-3-bromophenol (CAS: 74440-80-5) falls under the classification of a haza...

74440-80-54-Amino-3-bromopheno...
Compound Q&A

How should (17beta)-3-Oxoestr-4-en-17-yl acetate (CAS: 1425-10-1) be stored?

(17beta)-3-Oxoestr-4-en-17-yl acetate should be stored in a cool, dry place away...

1425-10-1(17beta)-3-Oxoestr-4...
Compound Q&A

What are the physical and chemical properties of 2-[(2,2-Diethoxyethyl)disulfanyl]-1,1-diethoxyethane (CAS: 76505-71-0)?

2-[(2,2-Diethoxyethyl)disulfanyl]-1,1-diethoxyethane (CAS: 76505-71-0) is a colo...

76505-71-02-[(2,2-Diethoxyethy...
Compound Q&A

What is the market or research trend for 1-(β-D-ribofuranosyl)-1H-imidazo[4,5-c]pyridin-4-amine?

The market and research for 1-(β-D-ribofuranosyl)-1H-imidazo[4,5-c]pyridin-4-ami...

6736-58-91-(beta-D-Ribofurano...