Compound Q&A

What industries use (5-Chloro-1-benzothiophen-2-yl)boronic acid (CAS: 867381-22-4)?

Answer

(5-Chloro-1-benzothiophen-2-yl)boronic acid
(5-Chloro-1-benzothiophen-2-yl)boronic acid is primarily used in the pharmaceutical industry for drug synthesis, particularly in the development of new medications. It is also used in the polymer industry as a monomer or catalyst. Additionally, it has applications in the production of sensors and semiconductors due to its ability to participate in various chemical reactions.

About

English Name (5-Chloro-1-benzothiophen-2-yl)boronic acid
Molecular Formula C8H6BClO2S
Molecular Weight 212.46599999999998 g/mol
SMILES B(C1=CC2=C(S1)C=CC(=C2)Cl)(O)O
InChIKey YNTMDEYDNLWCLF-UHFFFAOYSA-N
Last Updated: 2026-03-10 23:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5-Chloro-1-benzothiophen-2-yl)boronic acid (CAS: 867381-22-4)?

(5-Chloro-1-benzothiophen-2-yl)boronic acid is a white crystalline solid with a molecular weight of ...

Compound Q&A

How is (5-Chloro-1-benzothiophen-2-yl)boronic acid (CAS: 867381-22-4) typically synthesized?

(5-Chloro-1-benzothiophen-2-yl)boronic acid is typically synthesized via the Grignard reaction or or...

Compound Q&A

What precautions should be taken when handling (5-Chloro-1-benzothiophen-2-yl)boronic acid (CAS: 867381-22-4)?

When handling (5-Chloro-1-benzothiophen-2-yl)boronic acid, it is essential to wear appropriate perso...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...