Compound Q&A

What are the physical and chemical properties of (5-Chloro-1-benzothiophen-2-yl)boronic acid (CAS: 867381-22-4)?

Answer

(5-Chloro-1-benzothiophen-2-yl)boronic acid
(5-Chloro-1-benzothiophen-2-yl)boronic acid is a white crystalline solid with a molecular weight of approximately 317.04 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetonitrile. Chemically, it is less reactive than typical boronic acids and is often used in Suzuki coupling reactions. Its properties include good stability under normal laboratory conditions and a melting point around 160°C.

About

English Name (5-Chloro-1-benzothiophen-2-yl)boronic acid
Molecular Formula C8H6BClO2S
Molecular Weight 212.46599999999998 g/mol
SMILES B(C1=CC2=C(S1)C=CC(=C2)Cl)(O)O
InChIKey YNTMDEYDNLWCLF-UHFFFAOYSA-N
Last Updated: 2026-03-10 23:59

Related Q&A

Compound Q&A

How is (5-Chloro-1-benzothiophen-2-yl)boronic acid (CAS: 867381-22-4) typically synthesized?

(5-Chloro-1-benzothiophen-2-yl)boronic acid is typically synthesized via the Grignard reaction or or...

Compound Q&A

What industries use (5-Chloro-1-benzothiophen-2-yl)boronic acid (CAS: 867381-22-4)?

(5-Chloro-1-benzothiophen-2-yl)boronic acid is primarily used in the pharmaceutical industry for dru...

Compound Q&A

What precautions should be taken when handling (5-Chloro-1-benzothiophen-2-yl)boronic acid (CAS: 867381-22-4)?

When handling (5-Chloro-1-benzothiophen-2-yl)boronic acid, it is essential to wear appropriate perso...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...