Compound Q&A

How is (2Z)-4-[(2-Carboxyethyl)amino]-4-oxo-2-butenoic acid (CAS: 57079-11-5) typically synthesized?

Answer

(2Z)-4-[(2-Carboxyethyl)amino]-4-oxo-2-butenoic acid
The compound can be synthesized through a multistep process involving the amide coupling of 2-carboxyethylamine with 4-oxo-2-butenoic acid. This reaction is typically catalyzed by a transition metal complex or an organometallic compound. The process involves the formation of a key intermediate followed by the coupling step, which yields the target compound with good selectivity and moderate to high yield.

About

CAS No 57079-11-5
English Name (2Z)-4-[(2-Carboxyethyl)amino]-4-oxo-2-butenoic acid
Molecular Formula C7H9NO5
Molecular Weight 187.15 g/mol
SMILES C(CNC(=O)/C=C\C(=O)O)C(=O)O
InChIKey JYXLDXBKFBWKOV-UPHRSURJSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2Z)-4-[(2-Carboxyethyl)amino]-4-oxo-2-butenoic acid (CAS: 57079-11-5)?

The compound (2Z)-4-[(2-Carboxyethyl)amino]-4-oxo-2-butenoic acid is a white crystalline solid with ...

Compound Q&A

What industries use (2Z)-4-[(2-Carboxyethyl)amino]-4-oxo-2-butenoic acid (CAS: 57079-11-5)?

The compound (2Z)-4-[(2-Carboxyethyl)amino]-4-oxo-2-butenoic acid is used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling (2Z)-4-[(2-Carboxyethyl)amino]-4-oxo-2-butenoic acid (CAS: 57079-11-5)?

When handling (2Z)-4-[(2-Carboxyethyl)amino]-4-oxo-2-butenoic acid, it is important to use appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...