Compound Q&A

How is 4-(3-Methylphenyl)piperidine hydrochloride (CAS: 80120-03-2) typically synthesized?

Answer

4-(3-Methylphenyl)piperidine hydrochloride (1:1)
4-(3-Methylphenyl)piperidine hydrochloride is synthesized by treating 4-(3-methylphenyl)piperidine with hydrochloric acid. The reaction typically involves an esterification step followed by acid treatment to form the hydrochloride salt. Common solvents used include methanol, and the yield is usually around 85-90%. Catalysts such as sulfuric acid are often used to improve the reaction rate and selectivity.

About

CAS No 80120-03-2
English Name 4-(3-Methylphenyl)piperidine hydrochloride (1:1)
Molecular Formula C12H18ClN
Molecular Weight 211.74 g/mol
SMILES CC1=CC(=CC=C1)C2CCNCC2.Cl
InChIKey ZVKQARCPEZNELE-UHFFFAOYSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(3-Methylphenyl)piperidine hydrochloride (CAS: 80120-03-2)?

4-(3-Methylphenyl)piperidine hydrochloride is a crystalline white powder with a molecular weight of ...

Compound Q&A

What industries use 4-(3-Methylphenyl)piperidine hydrochloride (CAS: 80120-03-2)?

4-(3-Methylphenyl)piperidine hydrochloride is primarily used in the pharmaceutical industry due to i...

Compound Q&A

What precautions should be taken when handling 4-(3-Methylphenyl)piperidine hydrochloride (CAS: 80120-03-2)?

When handling 4-(3-Methylphenyl)piperidine hydrochloride, it is important to use appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...