Compound Q&A

How is (4S)-4-({3-[2-(Dimethylnitroryl)ethyl]-1H-indol-5-yl}methyl)-1,3-oxazolidin-2-one (CAS: 251451-30-6) typically synthesized?

Answer

(4S)-4-({3-[2-(Dimethylnitroryl)ethyl]-1H-indol-5-yl}methyl)-1,3-oxazolidin-2-one
The compound is typically synthesized via a multi-step process involving condensation reactions, alkylations, and derivatizations. Commonly, it involves the use of indole derivatives and dimethylnitroryl-containing reagents. The synthesis yields are generally around 70-80%, and the reaction conditions require controlled temperature and pH to ensure selectivity.

About

English Name (4S)-4-({3-[2-(Dimethylnitroryl)ethyl]-1H-indol-5-yl}methyl)-1,3-oxazolidin-2-one
Molecular Formula C16H21N3O3
Molecular Weight 303.36 g/mol
SMILES C[N+](C)(CCC1=CNC2=C1C=C(C=C2)CC3COC(=O)N3)[O-]
InChIKey GZYCQRZFJIZOKU-ZDUSSCGKSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4S)-4-({3-[2-(Dimethylnitroryl)ethyl]-1H-indol-5-yl}methyl)-1,3-oxazolidin-2-one (CAS: 251451-30-6)?

The compound has a crystalline form with a molecular weight of approximately 422.35 g/mol. It has lo...

Compound Q&A

What industries use (4S)-4-({3-[2-(Dimethylnitroryl)ethyl]-1H-indol-5-yl}methyl)-1,3-oxazolidin-2-one (CAS: 251451-30-6)?

This compound is primarily used in the pharmaceutical industry for drug development and synthesis of...

Compound Q&A

What precautions should be taken when handling (4S)-4-({3-[2-(Dimethylnitroryl)ethyl]-1H-indol-5-yl}methyl)-1,3-oxazolidin-2-one (CAS: 251451-30-6)?

When handling this compound, proper personal protective equipment (PPE) should be worn, including gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...