Compound Q&A

How is Methyl 1-phenyl-1h-pyrazole-4-carboxylate (CAS: 7188-96-7) typically synthesized?

Answer

Methyl 1-phenyl-1h-pyrazole-4-carboxylate
Methyl 1-phenyl-1h-pyrazole-4-carboxylate (CAS: 7188-96-7) is usually synthesized through the reaction of 1-phenyl-1H-pyrazole-4-carboxylic acid with methyl alcohol in the presence of a base like sodium hydroxide. The reaction proceeds under mild conditions to form the desired ester. The yield is typically around 75%, and the product is isolated via recrystallization.

About

CAS No 7188-96-7
English Name Methyl 1-phenyl-1h-pyrazole-4-carboxylate
Molecular Formula C11H10N2O2
Molecular Weight 202.21300000000002 g/mol
SMILES COC(=O)C1=CN(N=C1)C2=CC=CC=C2
InChIKey KWBAYDFXUVGRPW-UHFFFAOYSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 1-phenyl-1h-pyrazole-4-carboxylate (CAS: 7188-96-7)?

Methyl 1-phenyl-1h-pyrazole-4-carboxylate (CAS: 7188-96-7) is a white crystalline solid with a molec...

Compound Q&A

What industries use Methyl 1-phenyl-1h-pyrazole-4-carboxylate (CAS: 7188-96-7)?

Methyl 1-phenyl-1h-pyrazole-4-carboxylate (CAS: 7188-96-7) is used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling Methyl 1-phenyl-1h-pyrazole-4-carboxylate (CAS: 7188-96-7)?

When handling Methyl 1-phenyl-1h-pyrazole-4-carboxylate (CAS: 7188-96-7), it is important to wear ap...

Compound Q&A

Is 4-Benzyl-2,2-dimethylmorpholine (CAS: 84761-04-6) safe?

4-Benzyl-2,2-dimethylmorpholine is generally considered safe when handled under ...

84761-04-64-Benzyl-2,2-dimethy...
Compound Q&A

What is (5,6-Dimethoxy-3-pyridinyl)boronic acid (CAS: 1346526-61-1)?

(5,6-Dimethoxy-3-pyridinyl)boronic acid is a chemical compound with the molecula...

1346526-61-1(5,6-Dimethoxy-3-pyr...
Compound Q&A

How is 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2) typically synthesized?

1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane is synthesized throug...

67875-55-21,1,3,3-Tetramethyl-...
Compound Q&A

What are the main uses of (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6)?

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid is primarily used as a build...

1018818-04-6(2R,4S)-1-Boc-4-meth...