Compound Q&A

What are the physical and chemical properties of Methyl 1-phenyl-1h-pyrazole-4-carboxylate (CAS: 7188-96-7)?

Answer

Methyl 1-phenyl-1h-pyrazole-4-carboxylate
Methyl 1-phenyl-1h-pyrazole-4-carboxylate (CAS: 7188-96-7) is a white crystalline solid with a molecular weight of approximately 188.22 g/mol. It has a solubility of about 1.1 g/L in water. The compound is moderately reactive, showing basic properties and can form salts with acids. It exhibits good solubility in common organic solvents such as ethanol and acetone.

About

CAS No 7188-96-7
English Name Methyl 1-phenyl-1h-pyrazole-4-carboxylate
Molecular Formula C11H10N2O2
Molecular Weight 202.21300000000002 g/mol
SMILES COC(=O)C1=CN(N=C1)C2=CC=CC=C2
InChIKey KWBAYDFXUVGRPW-UHFFFAOYSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

How is Methyl 1-phenyl-1h-pyrazole-4-carboxylate (CAS: 7188-96-7) typically synthesized?

Methyl 1-phenyl-1h-pyrazole-4-carboxylate (CAS: 7188-96-7) is usually synthesized through the reacti...

Compound Q&A

What industries use Methyl 1-phenyl-1h-pyrazole-4-carboxylate (CAS: 7188-96-7)?

Methyl 1-phenyl-1h-pyrazole-4-carboxylate (CAS: 7188-96-7) is used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling Methyl 1-phenyl-1h-pyrazole-4-carboxylate (CAS: 7188-96-7)?

When handling Methyl 1-phenyl-1h-pyrazole-4-carboxylate (CAS: 7188-96-7), it is important to wear ap...

Compound Q&A

Is 4-Benzyl-2,2-dimethylmorpholine (CAS: 84761-04-6) safe?

4-Benzyl-2,2-dimethylmorpholine is generally considered safe when handled under ...

84761-04-64-Benzyl-2,2-dimethy...
Compound Q&A

What is (5,6-Dimethoxy-3-pyridinyl)boronic acid (CAS: 1346526-61-1)?

(5,6-Dimethoxy-3-pyridinyl)boronic acid is a chemical compound with the molecula...

1346526-61-1(5,6-Dimethoxy-3-pyr...
Compound Q&A

How is 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2) typically synthesized?

1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane is synthesized throug...

67875-55-21,1,3,3-Tetramethyl-...
Compound Q&A

What are the main uses of (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6)?

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid is primarily used as a build...

1018818-04-6(2R,4S)-1-Boc-4-meth...