Compound Q&A

How is 4-(1-Pyridiniumyl)-1-butanesulfonate (CAS: 21876-43-7) typically synthesized?

Answer

4-(1-Pyridiniumyl)-1-butanesulfonate
4-(1-Pyridiniumyl)-1-butanesulfonate is typically synthesized by the reaction of 1-butanesulfonic acid with 1-pyridinium chloride. The reaction proceeds via a substitution mechanism, where the sulfonate group displaces the chloride ion. The product is usually obtained with good yield and high selectivity. Common solvents used include water and various organic solvents.

About

CAS No 21876-43-7
English Name 4-(1-Pyridiniumyl)-1-butanesulfonate
Molecular Formula C9H13NO3S
Molecular Weight 217.2853 g/mol
SMILES c1ccc[nH+]c1.CCCCS(=O)(=O)[O-]
InChIKey DEHRBRNPZIHENL-UHFFFAOYSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(1-Pyridiniumyl)-1-butanesulfonate (CAS: 21876-43-7)?

4-(1-Pyridiniumyl)-1-butanesulfonate (CAS: 21876-43-7) is a crystalline solid with a molecular weigh...

Compound Q&A

What industries use 4-(1-Pyridiniumyl)-1-butanesulfonate (CAS: 21876-43-7)?

4-(1-Pyridiniumyl)-1-butanesulfonate (CAS: 21876-43-7) is used in various industries due to its basi...

Compound Q&A

What precautions should be taken when handling 4-(1-Pyridiniumyl)-1-butanesulfonate (CAS: 21876-43-7)?

When handling 4-(1-Pyridiniumyl)-1-butanesulfonate (CAS: 21876-43-7), appropriate personal protectiv...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...