Compound Q&A

What are the physical and chemical properties of 4-(1-Pyridiniumyl)-1-butanesulfonate (CAS: 21876-43-7)?

Answer

4-(1-Pyridiniumyl)-1-butanesulfonate
4-(1-Pyridiniumyl)-1-butanesulfonate (CAS: 21876-43-7) is a crystalline solid with a molecular weight of approximately 214.2 g/mol. It is moderately soluble in water and organic solvents. This compound exhibits basic properties due to the pyridinium group, and its reactivity is primarily influenced by its sulfonate functionality. The compound is stable under normal conditions but reacts with strong acids to form the corresponding anion.

About

CAS No 21876-43-7
English Name 4-(1-Pyridiniumyl)-1-butanesulfonate
Molecular Formula C9H13NO3S
Molecular Weight 217.2853 g/mol
SMILES c1ccc[nH+]c1.CCCCS(=O)(=O)[O-]
InChIKey DEHRBRNPZIHENL-UHFFFAOYSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

How is 4-(1-Pyridiniumyl)-1-butanesulfonate (CAS: 21876-43-7) typically synthesized?

4-(1-Pyridiniumyl)-1-butanesulfonate is typically synthesized by the reaction of 1-butanesulfonic ac...

Compound Q&A

What industries use 4-(1-Pyridiniumyl)-1-butanesulfonate (CAS: 21876-43-7)?

4-(1-Pyridiniumyl)-1-butanesulfonate (CAS: 21876-43-7) is used in various industries due to its basi...

Compound Q&A

What precautions should be taken when handling 4-(1-Pyridiniumyl)-1-butanesulfonate (CAS: 21876-43-7)?

When handling 4-(1-Pyridiniumyl)-1-butanesulfonate (CAS: 21876-43-7), appropriate personal protectiv...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...