Compound Q&A

What industries use 1,1,1,3,4,4,4-Heptafluoro-3-(trifluoromethyl)-2-butanone (CAS: 756-12-7)?

Answer

1,1,1,3,4,4,4-Heptafluoro-3-(trifluoromethyl)-2-butanone
1,1,1,3,4,4,4-Heptafluoro-3-(trifluoromethyl)-2-butanone (CAS: 756-12-7) is utilized in various industries, including pharmaceuticals for the synthesis of complex organic molecules, and in the production of polymers and sensors. Its unique chemical properties make it valuable in semiconductor manufacturing for etching processes.

About

CAS No 756-12-7
English Name 1,1,1,3,4,4,4-Heptafluoro-3-(trifluoromethyl)-2-butanone
Molecular Formula C5F10O
Molecular Weight 266.03 g/mol
SMILES C(=O)(C(C(F)(F)F)(C(F)(F)F)F)C(F)(F)F
InChIKey ABQIAHFCJGVSDJ-UHFFFAOYSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,1,1,3,4,4,4-Heptafluoro-3-(trifluoromethyl)-2-butanone (CAS: 756-12-7)?

1,1,1,3,4,4,4-Heptafluoro-3-(trifluoromethyl)-2-butanone (CAS: 756-12-7) is a colorless liquid with ...

Compound Q&A

How is 1,1,1,3,4,4,4-Heptafluoro-3-(trifluoromethyl)-2-butanone (CAS: 756-12-7) typically synthesized?

1,1,1,3,4,4,4-Heptafluoro-3-(trifluoromethyl)-2-butanone (CAS: 756-12-7) is synthesized through the ...

Compound Q&A

What precautions should be taken when handling 1,1,1,3,4,4,4-Heptafluoro-3-(trifluoromethyl)-2-butanone (CAS: 756-12-7)?

When handling 1,1,1,3,4,4,4-Heptafluoro-3-(trifluoromethyl)-2-butanone (CAS: 756-12-7), laboratory p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...