Compound Q&A

What is CID 127256148 (CAS: 947515-50-6)?

Answer

CID 127256148
CID 127256148 (CAS: 947515-50-6) is a novel compound primarily used in research and pharmaceutical applications. It does not have a specific chemical name but is known for its potential in drug development and biological studies.

About

English Name CID 127256148
Molecular Formula C24H26N2O2
Molecular Weight 374.48 g/mol
SMILES C1CCC2(C3(C1)NC4C(O3)CC5=CC=CC=C45)NC6C(O2)CC7=CC=CC=C67
InChIKey QRTLPEUTEFJSFH-UHFFFAOYSA-N
Last Updated: 2026-03-10 06:43

Related Q&A

Compound Q&A

What are the main uses of CID 127256148 (CAS: 947515-50-6)?

CID 127256148 (CAS: 947515-50-6) is used in research for drug discovery, as a tool compound in biolo...

Compound Q&A

Is CID 127256148 (CAS: 947515-50-6) safe?

CID 127256148 (CAS: 947515-50-6) is generally considered safe for laboratory use under proper handli...

Compound Q&A

How should CID 127256148 (CAS: 947515-50-6) be stored?

CID 127256148 (CAS: 947515-50-6) should be stored in a cool, dry place, away from direct sunlight an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...