Compound Q&A

What are the main uses of 3-(1-Aminoethyl)-5-(trifluoromethyl)aniline (CAS: 1213552-98-7)?

Answer

3-(1-Aminoethyl)-5-(trifluoromethyl)aniline
3-(1-Aminoethyl)-5-(trifluoromethyl)aniline is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It also finds applications in the research and development of new materials and as a reagent in chemical synthesis.

About

English Name 3-(1-Aminoethyl)-5-(trifluoromethyl)aniline
Molecular Formula C9H11F3N2
Molecular Weight 204.19 g/mol
SMILES CC(c1cc(cc(c1)N)C(F)(F)F)N
InChIKey SPYLLSKIPZGXNM-UHFFFAOYSA-N
Last Updated: 2026-03-09 18:34

Related Q&A

Compound Q&A

What is 3-(1-Aminoethyl)-5-(trifluoromethyl)aniline (CAS: 1213552-98-7)?

3-(1-Aminoethyl)-5-(trifluoromethyl)aniline is an organic compound with the CAS number 1213552-98-7....

Compound Q&A

Is 3-(1-Aminoethyl)-5-(trifluoromethyl)aniline (CAS: 1213552-98-7) safe?

3-(1-Aminoethyl)-5-(trifluoromethyl)aniline is generally considered safe when handled with appropria...

Compound Q&A

How should 3-(1-Aminoethyl)-5-(trifluoromethyl)aniline (CAS: 1213552-98-7) be stored?

3-(1-Aminoethyl)-5-(trifluoromethyl)aniline should be stored in a cool, dry place away from direct s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...