Compound Q&A

What are the main uses of (1Z)-N-Hydroxy-1,2-diphenylethanimine (CAS: 26306-06-9)?

Answer

(1Z)-N-Hydroxy-1,2-diphenylethanimine
(1Z)-N-Hydroxy-1,2-diphenylethanimine (CAS: 26306-06-9) is mainly used as an intermediate in pharmaceutical synthesis and as a reagent in organic chemistry. It plays a crucial role in the development of new drugs and chemical research.

About

CAS No 26306-06-9
English Name (1Z)-N-Hydroxy-1,2-diphenylethanimine
Molecular Formula C14H13NO
Molecular Weight 211.26 g/mol
SMILES O/N=C(/c1ccccc1)\Cc1ccccc1
InChIKey PWCUVRROUAKTLL-PFONDFGASA-N
Last Updated: 2026-03-09 18:34

Related Q&A

Compound Q&A

What is (1Z)-N-Hydroxy-1,2-diphenylethanimine (CAS: 26306-06-9)?

(1Z)-N-Hydroxy-1,2-diphenylethanimine (CAS: 26306-06-9) is a chemical compound used in pharmaceutica...

Compound Q&A

Is (1Z)-N-Hydroxy-1,2-diphenylethanimine (CAS: 26306-06-9) safe?

(1Z)-N-Hydroxy-1,2-diphenylethanimine (CAS: 26306-06-9) is generally safe when handled correctly. Us...

Compound Q&A

How should (1Z)-N-Hydroxy-1,2-diphenylethanimine (CAS: 26306-06-9) be stored?

(1Z)-N-Hydroxy-1,2-diphenylethanimine (CAS: 26306-06-9) should be stored in a cool, dry place away f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...