Compound Q&A

What is 2-(2-{2-[Bis(4-methoxyphenyl)(phenyl)methoxy]ethoxy}ethoxy)ethyl 2-cyanoethyl diisopropylphosphoramidoite (CAS: 146668-73-7)?

Answer

2-(2-{2-[Bis(4-methoxyphenyl)(phenyl)methoxy]ethoxy}ethoxy)ethyl 2-cyanoethyl diisopropylphosphoramidoite
2-(2-{2-[Bis(4-methoxyphenyl)(phenyl)methoxy]ethoxy}ethoxy)ethyl 2-cyanoethyl diisopropylphosphoramidoite is a complex organic compound with a unique molecular structure, characterized by its extensive substituents and functional groups. It is known for its stability and potential in various applications due to its chemical properties.

About

English Name 2-(2-{2-[Bis(4-methoxyphenyl)(phenyl)methoxy]ethoxy}ethoxy)ethyl 2-cyanoethyl diisopropylphosphoramidoite
Molecular Formula C36H49N2O7P
Molecular Weight 652.8 g/mol
SMILES CC(C)N(C(C)C)P(OCCC#N)OCCOCCOCCOC(C1=CC=CC=C1)(C2=CC=C(C=C2)OC)C3=CC=C(C=C3)OC
InChIKey PEJGGZVVBQPTRG-UHFFFAOYSA-N
Last Updated: 2026-03-09 18:34

Related Q&A

Compound Q&A

What are the main uses of 2-(2-{2-[Bis(4-methoxyphenyl)(phenyl)methoxy]ethoxy}ethoxy)ethyl 2-cyanoethyl diisopropylphosphoramidoite (CAS: 146668-73-7)?

This compound is primarily used in pharmaceuticals for its potential as a medicinal intermediate. It...

Compound Q&A

Is 2-(2-{2-[Bis(4-methoxyphenyl)(phenyl)methoxy]ethoxy}ethoxy)ethyl 2-cyanoethyl diisopropylphosphoramidoite (CAS: 146668-73-7) safe?

The safety of this compound depends on the conditions of use. It is generally considered safe when h...

Compound Q&A

How should 2-(2-{2-[Bis(4-methoxyphenyl)(phenyl)methoxy]ethoxy}ethoxy)ethyl 2-cyanoethyl diisopropylphosphoramidoite (CAS: 146668-73-7) be stored?

This compound should be stored in a cool, dry, and well-ventilated area. It should be kept in a tigh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...