Compound Q&A

How should 3-(2-Bromo-5-(trifluoromethyl)phenyl)propanoic acid (CAS: 869725-56-4) be stored?

Answer

3-(2-Bromo-5-(trifluoromethyl)phenyl)propanoic acid
3-(2-Bromo-5-(trifluoromethyl)phenyl)propanoic acid should be stored in a cool, dry place, away from direct sunlight and heat sources. The compound should be kept in a tightly sealed container to prevent moisture absorption. It is also advisable to store it in a well-ventilated area to avoid the risk of ignition. The container should be clearly labeled with the CAS number and appropriate safety information.

About

English Name 3-(2-Bromo-5-(trifluoromethyl)phenyl)propanoic acid
Molecular Formula C10H8BrF3O2
Molecular Weight 297.07 g/mol
SMILES C1=CC(=C(C=C1C(F)(F)F)CCC(=O)O)Br
InChIKey XPFCWQNQAZJJIE-UHFFFAOYSA-N
Last Updated: 2026-03-09 13:41

Related Q&A

Compound Q&A

What is 3-(2-Bromo-5-(trifluoromethyl)phenyl)propanoic acid (CAS: 869725-56-4)?

3-(2-Bromo-5-(trifluoromethyl)phenyl)propanoic acid is a chemical compound with the CAS number 86972...

Compound Q&A

What are the main uses of 3-(2-Bromo-5-(trifluoromethyl)phenyl)propanoic acid (CAS: 869725-56-4)?

3-(2-Bromo-5-(trifluoromethyl)phenyl)propanoic acid is primarily used in pharmaceuticals for the syn...

Compound Q&A

Is 3-(2-Bromo-5-(trifluoromethyl)phenyl)propanoic acid (CAS: 869725-56-4) safe?

3-(2-Bromo-5-(trifluoromethyl)phenyl)propanoic acid is generally considered safe when handled with a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...