Compound Q&A

What is 12-(Trichlorosilyl)dodecanenitrile (CAS: 724460-16-6)?

Answer

12-(Trichlorosilyl)dodecanenitrile is a chemical compound with the CAS number 724460-16-6. It is an organic nitrile with a 12-carbon backbone and a trichlorosilyl group attached to the 12th carbon atom. This compound is known for its stability and non-flammability, making it useful in various applications.

About

CAS No 724460-16-6

English Name 12-(Trichlorosilyl)dodecanenitrile

Molecular Formula C12H22Cl3NSi

Molecular Weight 17.031 g/mol

SMILES C(CCCCCC#N)CCCCC[Si](Cl)(Cl)Cl

InChIKey FSYDKNRLTBPQNZ-UHFFFAOYSA-N

Last Updated: 2026-03-09 13:41

Related Q&A

Compound Q&A

What are the main uses of 12-(Trichlorosilyl)dodecanenitrile (CAS: 724460-16-6)?

12-(Trichlorosilyl)dodecanenitrile (CAS: 724460-16-6) is primarily used in the synthesis of organosi...

Compound Q&A

Is 12-(Trichlorosilyl)dodecanenitrile (CAS: 724460-16-6) safe?

12-(Trichlorosilyl)dodecanenitrile is considered safe when handled correctly. It is non-toxic and no...

Compound Q&A

How should 12-(Trichlorosilyl)dodecanenitrile (CAS: 724460-16-6) be stored?

12-(Trichlorosilyl)dodecanenitrile (CAS: 724460-16-6) should be stored in a cool, dry place away fro...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What is 12-(Trichlorosilyl)dodecanenitrile (CAS: 724460-16-6)?

Answer

About

Related Q&A

What are the main uses of 12-(Trichlorosilyl)dodecanenitrile (CAS: 724460-16-6)?

Is 12-(Trichlorosilyl)dodecanenitrile (CAS: 724460-16-6) safe?

How should 12-(Trichlorosilyl)dodecanenitrile (CAS: 724460-16-6) be stored?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

ShangHaiMaiRuiErShengHua Technology Co Ltd

Hubei Hanwei Chemical Co., Ltd.

ShangHaiXinKaiYiYao Technology Co Ltd

Jin Jinle (Hunan) Chemical Co., Ltd.

JiangSuAiKangShengWuYiYaoYanFa Co Ltd

ShenZhenShiZhongFaYuan Biotechnology Co Ltd