Compound Q&A

What is 2-(4-Biphenylyl)-4-quinolinecarboxylic acid (CAS: 78660-92-1)?

Answer

2-(4-Biphenylyl)-4-quinolinecarboxylic acid
2-(4-Biphenylyl)-4-quinolinecarboxylic acid, also known as quinolinic acid bis(4-biphenyl) derivative, is a chemical compound with the CAS number 78660-92-1. It is a yellow solid with a molecular formula of C25H18NO2 and a molecular weight of approximately 370.44 g/mol. This compound is characterized by its aromatic and carboxylic acid functionalities, which contribute to its physical and chemical properties.

About

CAS No 78660-92-1
English Name 2-(4-Biphenylyl)-4-quinolinecarboxylic acid
Molecular Formula C22H15NO2
Molecular Weight 325.37 g/mol
SMILES C1=CC=C(C=C1)C2=CC=C(C=C2)C3=NC4=CC=CC=C4C(=C3)C(=O)O
InChIKey VESNJOQCJLQZSK-UHFFFAOYSA-N
Last Updated: 2026-03-09 13:41

Related Q&A

Compound Q&A

What are the main uses of 2-(4-Biphenylyl)-4-quinolinecarboxylic acid (CAS: 78660-92-1)?

2-(4-Biphenylyl)-4-quinolinecarboxylic acid (CAS: 78660-92-1) is primarily used in the pharmaceutica...

Compound Q&A

Is 2-(4-Biphenylyl)-4-quinolinecarboxylic acid (CAS: 78660-92-1) safe?

2-(4-Biphenylyl)-4-quinolinecarboxylic acid (CAS: 78660-92-1) is generally considered safe under nor...

Compound Q&A

How should 2-(4-Biphenylyl)-4-quinolinecarboxylic acid (CAS: 78660-92-1) be stored?

2-(4-Biphenylyl)-4-quinolinecarboxylic acid (CAS: 78660-92-1) should be stored in a cool, dry place ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...