Compound Q&A

Are there alternatives to 2-(4-Pyridinyl)terephthalic acid (CAS: 1238617-40-7) in synthesis?

Answer

2-(4-Pyridinyl)terephthalic acid
Several alternatives can be used in the synthesis of 2-(4-Pyridinyl)terephthalic acid. Common substitutes include other terephthalic acid derivatives such as 2-(3-pyridinyl)terephthalic acid and 2-(5-pyridinyl)terephthalic acid. Additionally, isomers like 3-(4-pyridinyl)terephthalic acid can serve as viable alternatives depending on the specific reaction conditions and desired properties.

About

English Name 2-(4-Pyridinyl)terephthalic acid
Molecular Formula C13H9NO4
Molecular Weight 243.22 g/mol
SMILES OC(=O)c1ccc(c(c1)c1ccncc1)C(=O)O
InChIKey HKLXQHZNQUNGEK-UHFFFAOYSA-N
Last Updated: 2026-03-09 09:59

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-(4-Pyridinyl)terephthalic acid (CAS: 1238617-40-7)?

2-(4-Pyridinyl)terephthalic acid (CAS: 1238617-40-7) falls under the purview of several regulatory f...

Compound Q&A

What is the market or research trend for 2-(4-Pyridinyl)terephthalic acid (CAS: 1238617-40-7)?

The market for 2-(4-Pyridinyl)terephthalic acid (CAS: 1238617-40-7) is driven by its applications in...

Compound Q&A

How should waste containing 2-(4-Pyridinyl)terephthalic acid (CAS: 1238617-40-7) be handled?

Waste containing 2-(4-Pyridinyl)terephthalic acid (CAS: 1238617-40-7) should be collected in appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...