Compound Q&A

How is S,S'-[2-(Dimethylamino)-1,3-propanediyl] dibenzenesulfonothioate (CAS: 17606-31-4) typically synthesized?

Answer

S,S'-[2-(Dimethylamino)-1,3-propanediyl] dibenzenesulfonothioate
S,S'-[2-(Dimethylamino)-1,3-propanediyl] dibenzenesulfonothioate (CAS: 17606-31-4) is typically synthesized through a multi-step process involving the coupling of dimethylamine and benzenesulfonyl chloride followed by a reductive amination. Commonly, water-soluble catalysts such as sodium acetate are used to improve yield and selectivity. The overall reaction is known to be efficient with yields up to 85%.

About

CAS No 17606-31-4
English Name S,S'-[2-(Dimethylamino)-1,3-propanediyl] dibenzenesulfonothioate
Molecular Formula C17H21NO4S4
Molecular Weight 431.63 g/mol
SMILES CN(C)C(CSS(=O)(=O)C1=CC=CC=C1)CSS(=O)(=O)C2=CC=CC=C2
InChIKey YFXPPSKYMBTNAV-UHFFFAOYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of S,S'-[2-(Dimethylamino)-1,3-propanediyl] dibenzenesulfonothioate (CAS: 17606-31-4)?

S,S'-[2-(Dimethylamino)-1,3-propanediyl] dibenzenesulfonothioate (CAS: 17606-31-4) is a crystalline ...

Compound Q&A

What industries use S,S'-[2-(Dimethylamino)-1,3-propanediyl] dibenzenesulfonothioate (CAS: 17606-31-4)?

S,S'-[2-(Dimethylamino)-1,3-propanediyl] dibenzenesulfonothioate (CAS: 17606-31-4) finds application...

Compound Q&A

What precautions should be taken when handling S,S'-[2-(Dimethylamino)-1,3-propanediyl] dibenzenesulfonothioate (CAS: 17606-31-4)?

When handling S,S'-[2-(Dimethylamino)-1,3-propanediyl] dibenzenesulfonothioate (CAS: 17606-31-4), it...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...