Compound Q&A

What industries use [4-(4-cyanophenyl)phenyl] 4-propylcyclohexanecarboxylate (CAS: 67284-57-5)?

Answer

[4-(4-cyanophenyl)phenyl] 4-propylcyclohexanecarboxylate
[4-(4-cyanophenyl)phenyl] 4-propylcyclohexanecarboxylate is primarily used in the pharmaceutical industry for its potential as a precursor in the synthesis of drug molecules. It also finds applications in the polymer industry as a monomer or additive. Additionally, this compound can be used in the development of sensors and semiconductors due to its unique chemical structure.

About

CAS No 67284-57-5
English Name [4-(4-cyanophenyl)phenyl] 4-propylcyclohexanecarboxylate
Molecular Formula C23H25NO2
Molecular Weight 347.4 g/mol
SMILES CCCC1CCC(CC1)C(=O)OC2=CC=C(C=C2)C3=CC=C(C=C3)C#N
InChIKey YVEDSNAPDAXLDD-CYWCHRQTSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-(4-cyanophenyl)phenyl] 4-propylcyclohexanecarboxylate (CAS: 67284-57-5)?

[4-(4-cyanophenyl)phenyl] 4-propylcyclohexanecarboxylate has a crystalline form at room temperature ...

Compound Q&A

How is [4-(4-cyanophenyl)phenyl] 4-propylcyclohexanecarboxylate (CAS: 67284-57-5) typically synthesized?

[4-(4-cyanophenyl)phenyl] 4-propylcyclohexanecarboxylate can be synthesized through a multi-step pro...

Compound Q&A

What precautions should be taken when handling [4-(4-cyanophenyl)phenyl] 4-propylcyclohexanecarboxylate (CAS: 67284-57-5)?

When handling [4-(4-cyanophenyl)phenyl] 4-propylcyclohexanecarboxylate, it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...