Compound Q&A

What precautions should be taken when handling 4-Ethyl-D-phenylalanine (CAS: 721385-17-7)?

Answer

4-Ethyl-D-phenylalanine
When handling 4-Ethyl-D-phenylalanine, it is important to use appropriate personal protective equipment (PPE) such as gloves and goggles. The material should be stored in a cool, dry place away from direct sunlight and heat sources. In case of a spill, handle it in a well-ventilated area and follow standard chemical spill procedures. Always refer to the Safety Data Sheet (SDS) for detailed handling and safety information.

About

English Name 4-Ethyl-D-phenylalanine
Molecular Formula C11H15NO2
Molecular Weight 193.25 g/mol
SMILES CCC1=CC=C(C=C1)CC(C(=O)O)N
InChIKey AWKDBHFQJATNBQ-SNVBAGLBSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Ethyl-D-phenylalanine (CAS: 721385-17-7)?

4-Ethyl-D-phenylalanine is a white crystalline solid with a molecular weight of approximately 186.25...

Compound Q&A

How is 4-Ethyl-D-phenylalanine (CAS: 721385-17-7) typically synthesized?

4-Ethyl-D-phenylalanine is typically synthesized through a condensation reaction between D-phenylala...

Compound Q&A

What industries use 4-Ethyl-D-phenylalanine (CAS: 721385-17-7)?

4-Ethyl-D-phenylalanine is primarily used in the pharmaceutical industry for the development of pept...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...