Compound Q&A

What are the physical and chemical properties of Dehydrocurvularin (CAS: 1095588-70-7)?

Answer

Dehydrocurvularin
Dehydrocurvularin (CAS: 1095588-70-7) is a crystalline compound with a molecular weight of approximately 608.54 g/mol. It has a solubility of about 34 mg/L in water and is slightly soluble in organic solvents. This compound is relatively stable under normal conditions but can react with strong oxidizing agents. It is typically found in its crystalline form and exhibits low reactivity under standard laboratory conditions.

About

English Name Dehydrocurvularin
Molecular Formula C16H18O5
Molecular Weight 290.32 g/mol
SMILES CC1CCCC=CC(=O)C2=C(CC(=O)O1)C=C(C=C2O)O
InChIKey AVIRMQMUBGNCKS-RWCYGVJQSA-N
Last Updated: 2026-03-08 04:51

Related Q&A

Compound Q&A

How is Dehydrocurvularin (CAS: 1095588-70-7) typically synthesized?

Dehydrocurvularin (CAS: 1095588-70-7) is synthesized via a multi-step organic synthesis process, sta...

Compound Q&A

What industries use Dehydrocurvularin (CAS: 1095588-70-7)?

Dehydrocurvularin (CAS: 1095588-70-7) is primarily used in the pharmaceutical industry for its poten...

Compound Q&A

What precautions should be taken when handling Dehydrocurvularin (CAS: 1095588-70-7)?

When handling Dehydrocurvularin (CAS: 1095588-70-7), it is essential to use personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...