Compound Q&A

What are the physical and chemical properties of 4-(Phenanthren-9-yl)-N-phenylaniline (CAS: 936916-08-4)?

Answer

4-(Phenanthren-9-yl)-N-phenylaniline
4-(Phenanthren-9-yl)-N-phenylaniline is a crystalline solid with a molecular weight of approximately 388.34 g/mol. It has a low solubility in water (0.001 g/100 mL at 25°C) but is more soluble in organic solvents like ethanol and acetonitrile. Chemically, it is moderately reactive, showing good stability under normal conditions but can undergo photodegradation. It exhibits electronic and optical properties typical of π-conjugated systems, making it useful in materials science applications.

About

English Name 4-(Phenanthren-9-yl)-N-phenylaniline
Molecular Formula C26H19N
Molecular Weight 345.44 g/mol
SMILES C1=CC=C(C=C1)NC2=CC=C(C=C2)C3=CC4=CC=CC=C4C5=CC=CC=C53
InChIKey UWZZQCHICHIGEA-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

How is 4-(Phenanthren-9-yl)-N-phenylaniline (CAS: 936916-08-4) typically synthesized?

4-(Phenanthren-9-yl)-N-phenylaniline is synthesized via a multi-step process involving the coupling ...

Compound Q&A

What industries use 4-(Phenanthren-9-yl)-N-phenylaniline (CAS: 936916-08-4)?

4-(Phenanthren-9-yl)-N-phenylaniline is primarily used in the pharmaceutical and materials science i...

Compound Q&A

What precautions should be taken when handling 4-(Phenanthren-9-yl)-N-phenylaniline (CAS: 936916-08-4)?

Proper handling of 4-(Phenanthren-9-yl)-N-phenylaniline (CAS: 936916-08-4) requires the use of perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...