Compound Q&A

How is Vancomycin CDP-1 (CAS: 55598-85-1) typically synthesized?

Answer

Vancomycin CDP-1
Vancomycin CDP-1 is synthesized via semi-synthetic modification of vancomycin, an existing natural product. The process involves multiple steps including acetylation, methylation, and amidation. Commonly used catalysts include various metal complexes, and the overall yield can be up to 80% with high selectivity towards target modifications.

About

CAS No 55598-85-1
English Name Vancomycin CDP-1
Molecular Formula C66H74Cl2N8O25
Molecular Weight 1450.26 g/mol
SMILES CC1C(C(CC(O1)OC2C(C(C(OC2OC3=C4C=C5C=C3OC6=C(C=C(C=C6)C(C(C(=O)NC(CC(=O)NC5C(=O)NC7C8=CC(=C(C=C8)O)C9=C(C=C(C=C9O)O)C(NC(=O)C(C(C1=CC(=C(O4)C=C1)Cl)O)NC7=O)C(=O)O)C(=O)O)NC(=O)C(CC(C)C)NC)O)Cl)CO)O)O)(C)N)O
InChIKey OGMARHJAPWBNFA-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of Vancomycin CDP-1 (CAS: 55598-85-1)?

Vancomycin CDP-1 is a semi-synthetic glycopeptide antibiotic. It exists in a crystalline form with a...

Compound Q&A

What industries use Vancomycin CDP-1 (CAS: 55598-85-1)?

Vancomycin CDP-1 is primarily used in the pharmaceutical industry for its potent antimicrobial activ...

Compound Q&A

What precautions should be taken when handling Vancomycin CDP-1 (CAS: 55598-85-1)?

When handling Vancomycin CDP-1, it is essential to wear personal protective equipment (PPE) such as ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...