Compound Q&A

What are the physical and chemical properties of Ethyl (Z)-3-(tributylstannyl)acrylate (CAS: 82101-76-6)?

Answer

Ethyl (Z)-3-(tributylstannyl)acrylate
Ethyl (Z)-3-(tributylstannyl)acrylate is a colorless liquid with a molecular weight of approximately 360.4 g/mol. It has a low solubility in water but is soluble in organic solvents like chloroform and acetone. Chemically, it is highly reactive due to the presence of the acrylate group and the tributylstannyl moiety, making it useful for various polymerization reactions.

About

CAS No 82101-76-6
English Name Ethyl (Z)-3-(tributylstannyl)acrylate
Molecular Formula C17H34O2Sn
Molecular Weight 389.17 g/mol
SMILES CCCC[Sn](/C=C\C(=O)OCC)(CCCC)CCCC
InChIKey XBFWLXIOONPQFL-UHFFFAOYSA-N
Last Updated: 2026-03-07 19:49

Related Q&A

Compound Q&A

How is Ethyl (Z)-3-(tributylstannyl)acrylate (CAS: 82101-76-6) typically synthesized?

Ethyl (Z)-3-(tributylstannyl)acrylate is synthesized via the coupling of ethyl acrylate with tributy...

Compound Q&A

What industries use Ethyl (Z)-3-(tributylstannyl)acrylate (CAS: 82101-76-6)?

Ethyl (Z)-3-(tributylstannyl)acrylate is primarily used in the polymer industry for the preparation ...

Compound Q&A

What precautions should be taken when handling Ethyl (Z)-3-(tributylstannyl)acrylate (CAS: 82101-76-6)?

When handling Ethyl (Z)-3-(tributylstannyl)acrylate, it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...