Compound Q&A

What industries use Ethyl difluoro(3-methoxyphenyl)acetate (CAS: 915133-57-2)?

Answer

Ethyl difluoro(3-methoxyphenyl)acetate
Ethyl difluoro(3-methoxyphenyl)acetate finds applications in the pharmaceutical industry as a precursor for the synthesis of various drugs. It is also used in the polymer industry to modify the properties of polymers. Additionally, it plays a role in the development of sensors and semiconductors due to its unique electronic properties.

About

English Name Ethyl difluoro(3-methoxyphenyl)acetate
Molecular Formula C11H12F2O3
Molecular Weight 230.21 g/mol
SMILES CCOC(=O)C(C1=CC(=CC=C1)OC)(F)F
InChIKey YPPCAEMLMPUOIM-UHFFFAOYSA-N
Last Updated: 2026-03-07 19:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl difluoro(3-methoxyphenyl)acetate (CAS: 915133-57-2)?

Ethyl difluoro(3-methoxyphenyl)acetate is a colorless to light yellow liquid with a molecular weight...

Compound Q&A

How is Ethyl difluoro(3-methoxyphenyl)acetate (CAS: 915133-57-2) typically synthesized?

Ethyl difluoro(3-methoxyphenyl)acetate is usually synthesized via a reaction between 3-methoxyphenyl...

Compound Q&A

What precautions should be taken when handling Ethyl difluoro(3-methoxyphenyl)acetate (CAS: 915133-57-2)?

When handling Ethyl difluoro(3-methoxyphenyl)acetate, it is essential to wear appropriate personal p...

Compound Q&A

What are the main uses of Methyl cellulose (CAS: 9004-67-5)?

Methyl cellulose is widely used in pharmaceuticals as a binder and disintegrant ...

9004-67-5Methyl cellulose
Compound Q&A

How is Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride (CAS: 1170782-90-7) typically synthesized?

Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride is typically synthes...

1170782-90-7Methyl 1-(aminomethy...
Compound Q&A

How should Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate (CAS: 371945-06-1) be stored?

Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate should be stored in a cool, dry p...

371945-06-1Ethyl 3-aminofuro[2,...
Compound Q&A

What are the main uses of (2,4-Difluoro-3-isopropoxyphenyl)boronic acid (CAS: 1451390-95-6)?

(2,4-Difluoro-3-isopropoxyphenyl)boronic acid is primarily used in organic synth...

1451390-95-6(2,4-Difluoro-3-isop...