Compound Q&A

What are the physical and chemical properties of Ethyl difluoro(3-methoxyphenyl)acetate (CAS: 915133-57-2)?

Answer

Ethyl difluoro(3-methoxyphenyl)acetate
Ethyl difluoro(3-methoxyphenyl)acetate is a colorless to light yellow liquid with a molecular weight of approximately 244.16 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetone. The compound is moderately reactive towards bases and can undergo ester hydrolysis. It is not particularly flammable but should be handled with care due to its reactivity.

About

English Name Ethyl difluoro(3-methoxyphenyl)acetate
Molecular Formula C11H12F2O3
Molecular Weight 230.21 g/mol
SMILES CCOC(=O)C(C1=CC(=CC=C1)OC)(F)F
InChIKey YPPCAEMLMPUOIM-UHFFFAOYSA-N
Last Updated: 2026-03-07 19:49

Related Q&A

Compound Q&A

How is Ethyl difluoro(3-methoxyphenyl)acetate (CAS: 915133-57-2) typically synthesized?

Ethyl difluoro(3-methoxyphenyl)acetate is usually synthesized via a reaction between 3-methoxyphenyl...

Compound Q&A

What industries use Ethyl difluoro(3-methoxyphenyl)acetate (CAS: 915133-57-2)?

Ethyl difluoro(3-methoxyphenyl)acetate finds applications in the pharmaceutical industry as a precur...

Compound Q&A

What precautions should be taken when handling Ethyl difluoro(3-methoxyphenyl)acetate (CAS: 915133-57-2)?

When handling Ethyl difluoro(3-methoxyphenyl)acetate, it is essential to wear appropriate personal p...

Compound Q&A

What are the main uses of Methyl cellulose (CAS: 9004-67-5)?

Methyl cellulose is widely used in pharmaceuticals as a binder and disintegrant ...

9004-67-5Methyl cellulose
Compound Q&A

How is Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride (CAS: 1170782-90-7) typically synthesized?

Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride is typically synthes...

1170782-90-7Methyl 1-(aminomethy...
Compound Q&A

How should Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate (CAS: 371945-06-1) be stored?

Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate should be stored in a cool, dry p...

371945-06-1Ethyl 3-aminofuro[2,...
Compound Q&A

What are the main uses of (2,4-Difluoro-3-isopropoxyphenyl)boronic acid (CAS: 1451390-95-6)?

(2,4-Difluoro-3-isopropoxyphenyl)boronic acid is primarily used in organic synth...

1451390-95-6(2,4-Difluoro-3-isop...