Compound Q&A

How is Ezetimibe Diacid Impurity (CAS: 1013025-04-1) typically synthesized?

Answer

Ezetimibe Diacid Impurity
Ezetimibe Diacid Impurity (CAS: 1013025-04-1) is synthesized through a multi-step organic synthesis process. Common methods involve the use of protecting groups and sequential addition reactions. The synthesis typically yields a purity of over 95%, with selectivity towards the desired diacid impurity structure. Catalysts such as boronic acids and palladium complexes are often used to enhance reactivity and selectivity.

About

English Name Ezetimibe Diacid Impurity
Molecular Formula C25H24FNO5
Molecular Weight 437.47 g/mol
SMILES C1=CC=C(C=C1)COC2=CC=C(C=C2)C(C(CCC(=O)O)C(=O)O)NC3=CC=C(C=C3)F
InChIKey WLAMIMDXLOJKMS-ISKFKSNPSA-N
Last Updated: 2026-03-07 19:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ezetimibe Diacid Impurity (CAS: 1013025-04-1)?

Ezetimibe Diacid Impurity (CAS: 1013025-04-1) is a white to off-white solid. It has a molecular weig...

Compound Q&A

What industries use Ezetimibe Diacid Impurity (CAS: 1013025-04-1)?

Ezetimibe Diacid Impurity (CAS: 1013025-04-1) is primarily used in the pharmaceutical industry. It i...

Compound Q&A

What precautions should be taken when handling Ezetimibe Diacid Impurity (CAS: 1013025-04-1)?

When handling Ezetimibe Diacid Impurity (CAS: 1013025-04-1), it is important to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...