Compound Q&A

What are the physical and chemical properties of Benzyl 4-iodo-1H-pyrazole-1-carboxylate (CAS: 952338-83-9)?

Answer

Benzyl 4-iodo-1H-pyrazole-1-carboxylate
Benzyl 4-iodo-1H-pyrazole-1-carboxylate (CAS: 952338-83-9) is a crystalline solid with a molecular weight of approximately 315.03 g/mol. It is poorly soluble in water but soluble in organic solvents. The compound is reactive towards nucleophiles due to the presence of the iodine and carboxylate groups. It has a pKa around 4.5, indicating basicity.

About

English Name Benzyl 4-iodo-1H-pyrazole-1-carboxylate
Molecular Formula C11H9IN2O2
Molecular Weight 328.11 g/mol
SMILES C1=CC=C(C=C1)COC(=O)N2C=C(C=N2)I
InChIKey RMOBSWZFJWFDMF-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

How is Benzyl 4-iodo-1H-pyrazole-1-carboxylate (CAS: 952338-83-9) typically synthesized?

Benzyl 4-iodo-1H-pyrazole-1-carboxylate is typically synthesized by reacting 4-iodopyrazole-1-carbox...

Compound Q&A

What industries use Benzyl 4-iodo-1H-pyrazole-1-carboxylate (CAS: 952338-83-9)?

Benzyl 4-iodo-1H-pyrazole-1-carboxylate (CAS: 952338-83-9) is used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling Benzyl 4-iodo-1H-pyrazole-1-carboxylate (CAS: 952338-83-9)?

When handling Benzyl 4-iodo-1H-pyrazole-1-carboxylate (CAS: 952338-83-9), wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...