Compound Q&A

What are the physical and chemical properties of [3-Methoxy-4-(4-methyl-1H-imidazol-1-yl)phenyl]methanol (CAS: 1017789-63-7)?

Answer

[3-Methoxy-4-(4-methyl-1H-imidazol-1-yl)phenyl]methanol
[3-Methoxy-4-(4-methyl-1H-imidazol-1-yl)phenyl]methanol is a white crystalline solid with a molecular weight of approximately 249.34 g/mol. It has a high solubility in organic solvents such as methanol and ethanol but is only slightly soluble in water. This compound is relatively stable under normal conditions but may react with strong acids or bases. It is used in various applications due to its chemical reactivity.

About

English Name [3-Methoxy-4-(4-methyl-1H-imidazol-1-yl)phenyl]methanol
Molecular Formula C12H14N2O2
Molecular Weight 218.26 g/mol
SMILES CC1=CN(C=N1)C2=C(C=C(C=C2)CO)OC
InChIKey WJPVRAIPKWEAHT-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

How is [3-Methoxy-4-(4-methyl-1H-imidazol-1-yl)phenyl]methanol (CAS: 1017789-63-7) typically synthesized?

[3-Methoxy-4-(4-methyl-1H-imidazol-1-yl)phenyl]methanol can be synthesized through a multi-step proc...

Compound Q&A

What industries use [3-Methoxy-4-(4-methyl-1H-imidazol-1-yl)phenyl]methanol (CAS: 1017789-63-7)?

[3-Methoxy-4-(4-methyl-1H-imidazol-1-yl)phenyl]methanol is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling [3-Methoxy-4-(4-methyl-1H-imidazol-1-yl)phenyl]methanol (CAS: 1017789-63-7)?

When handling [3-Methoxy-4-(4-methyl-1H-imidazol-1-yl)phenyl]methanol, it is essential to wear perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...