Compound Q&A

What industries use Ethyl N-(diphenylmethylene)-4-methylenenorvalinate (CAS: 80741-44-2)?

Answer

Ethyl N-(diphenylmethylene)-4-methylenenorvalinate
Ethyl N-(diphenylmethylene)-4-methylenenorvalinate is used in the pharmaceutical industry for the synthesis of certain drug intermediates. It is also utilized in the polymer industry for modifying polymer properties and in the chemical sensor industry for specific chemical detection applications.

About

CAS No 80741-44-2
English Name Ethyl N-(diphenylmethylene)-4-methylenenorvalinate
Molecular Formula C21H23NO2
Molecular Weight 321.42 g/mol
SMILES CCOC(=O)C(CC(=C)C)N=C(c1ccccc1)c2ccccc2
InChIKey CFNAHFDKBOHIBD-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl N-(diphenylmethylene)-4-methylenenorvalinate (CAS: 80741-44-2)?

Ethyl N-(diphenylmethylene)-4-methylenenorvalinate is a crystalline compound with a molecular weight...

Compound Q&A

How is Ethyl N-(diphenylmethylene)-4-methylenenorvalinate (CAS: 80741-44-2) typically synthesized?

Ethyl N-(diphenylmethylene)-4-methylenenorvalinate is typically synthesized via esterification of di...

Compound Q&A

What precautions should be taken when handling Ethyl N-(diphenylmethylene)-4-methylenenorvalinate (CAS: 80741-44-2)?

Proper personal protective equipment (PPE) should be worn when handling this compound, including glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...