Compound Q&A

How is 1-(2,4-Bis(benzyloxy)-5-isopropylphenyl)ethanone (CAS: 747414-18-2) typically synthesized?

Answer

1-(2,4-Bis(benzyloxy)-5-isopropylphenyl)ethanone
1-(2,4-Bis(benzyloxy)-5-isopropylphenyl)ethanone is typically synthesized via a multistep process involving the protection of a phenolic hydroxyl group and subsequent coupling reactions. The key steps involve the formation of benzyl ethers followed by the introduction of an isopropyl group, often using catalytic amounts of palladium or other suitable catalysts to ensure high selectivity and yield.

About

English Name 1-(2,4-Bis(benzyloxy)-5-isopropylphenyl)ethanone
Molecular Formula C25H26O3
Molecular Weight 374.4800000000001 g/mol
SMILES CC(C)C1=CC(=C(C=C1OCC2=CC=CC=C2)OCC3=CC=CC=C3)C(=O)C
InChIKey RLXQJELUJMDJFL-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(2,4-Bis(benzyloxy)-5-isopropylphenyl)ethanone (CAS: 747414-18-2)?

1-(2,4-Bis(benzyloxy)-5-isopropylphenyl)ethanone is a colorless to white crystalline solid with a mo...

Compound Q&A

What industries use 1-(2,4-Bis(benzyloxy)-5-isopropylphenyl)ethanone (CAS: 747414-18-2)?

1-(2,4-Bis(benzyloxy)-5-isopropylphenyl)ethanone is used in the pharmaceutical industry for the synt...

Compound Q&A

What precautions should be taken when handling 1-(2,4-Bis(benzyloxy)-5-isopropylphenyl)ethanone (CAS: 747414-18-2)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What are the main uses of Methyl cellulose (CAS: 9004-67-5)?

Methyl cellulose is widely used in pharmaceuticals as a binder and disintegrant ...

9004-67-5Methyl cellulose
Compound Q&A

How is Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride (CAS: 1170782-90-7) typically synthesized?

Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride is typically synthes...

1170782-90-7Methyl 1-(aminomethy...
Compound Q&A

How should Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate (CAS: 371945-06-1) be stored?

Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate should be stored in a cool, dry p...

371945-06-1Ethyl 3-aminofuro[2,...
Compound Q&A

What are the main uses of (2,4-Difluoro-3-isopropoxyphenyl)boronic acid (CAS: 1451390-95-6)?

(2,4-Difluoro-3-isopropoxyphenyl)boronic acid is primarily used in organic synth...

1451390-95-6(2,4-Difluoro-3-isop...