Compound Q&A

What are the physical and chemical properties of 1-(2,4-Bis(benzyloxy)-5-isopropylphenyl)ethanone (CAS: 747414-18-2)?

Answer

1-(2,4-Bis(benzyloxy)-5-isopropylphenyl)ethanone
1-(2,4-Bis(benzyloxy)-5-isopropylphenyl)ethanone is a colorless to white crystalline solid with a molecular weight of 518.66 g/mol. It has a melting point of 96-97°C and is slightly soluble in common organic solvents like dichloromethane and methanol. This compound is known for its reactivity towards nucleophiles and its stability under basic conditions.

About

English Name 1-(2,4-Bis(benzyloxy)-5-isopropylphenyl)ethanone
Molecular Formula C25H26O3
Molecular Weight 374.4800000000001 g/mol
SMILES CC(C)C1=CC(=C(C=C1OCC2=CC=CC=C2)OCC3=CC=CC=C3)C(=O)C
InChIKey RLXQJELUJMDJFL-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

How is 1-(2,4-Bis(benzyloxy)-5-isopropylphenyl)ethanone (CAS: 747414-18-2) typically synthesized?

1-(2,4-Bis(benzyloxy)-5-isopropylphenyl)ethanone is typically synthesized via a multistep process in...

Compound Q&A

What industries use 1-(2,4-Bis(benzyloxy)-5-isopropylphenyl)ethanone (CAS: 747414-18-2)?

1-(2,4-Bis(benzyloxy)-5-isopropylphenyl)ethanone is used in the pharmaceutical industry for the synt...

Compound Q&A

What precautions should be taken when handling 1-(2,4-Bis(benzyloxy)-5-isopropylphenyl)ethanone (CAS: 747414-18-2)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What are the main uses of Methyl cellulose (CAS: 9004-67-5)?

Methyl cellulose is widely used in pharmaceuticals as a binder and disintegrant ...

9004-67-5Methyl cellulose
Compound Q&A

How is Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride (CAS: 1170782-90-7) typically synthesized?

Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride is typically synthes...

1170782-90-7Methyl 1-(aminomethy...
Compound Q&A

How should Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate (CAS: 371945-06-1) be stored?

Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate should be stored in a cool, dry p...

371945-06-1Ethyl 3-aminofuro[2,...
Compound Q&A

What are the main uses of (2,4-Difluoro-3-isopropoxyphenyl)boronic acid (CAS: 1451390-95-6)?

(2,4-Difluoro-3-isopropoxyphenyl)boronic acid is primarily used in organic synth...

1451390-95-6(2,4-Difluoro-3-isop...