Compound Q&A

What industries use Zinc bis(4-methylbenzenesulfinate) (CAS: 24345-02-6)?

Answer

Zinc bis(4-methylbenzenesulfinate)
Zinc bis(4-methylbenzenesulfinate) (CAS: 24345-02-6) is used in various industries, including pharmaceuticals for its ligand properties, in polymer synthesis as a stabilizer, and in sensors and semiconductors for its redox properties. Its unique chemical properties make it a valuable reagent in the development of new materials and functional molecules.

About

CAS No 24345-02-6
English Name Zinc bis(4-methylbenzenesulfinate)
Molecular Formula C14H14O4S2Zn
Molecular Weight 375.79 g/mol
SMILES CC1=CC=C(C=C1)S(=O)[O-].CC1=CC=C(C=C1)S(=O)[O-].[Zn+2]
InChIKey KHYUFILZGMOXBR-UHFFFAOYSA-L
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of Zinc bis(4-methylbenzenesulfinate) (CAS: 24345-02-6)?

Zinc bis(4-methylbenzenesulfinate) (CAS: 24345-02-6) is a white crystalline solid with a molecular w...

Compound Q&A

How is Zinc bis(4-methylbenzenesulfinate) (CAS: 24345-02-6) typically synthesized?

Zinc bis(4-methylbenzenesulfinate) (CAS: 24345-02-6) is typically synthesized by reacting zinc sulfi...

Compound Q&A

What precautions should be taken when handling Zinc bis(4-methylbenzenesulfinate) (CAS: 24345-02-6)?

When handling Zinc bis(4-methylbenzenesulfinate) (CAS: 24345-02-6), it is important to use appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...