Compound Q&A

What are the physical and chemical properties of Bisphenol A-d16 (CAS: 96210-87-6)?

Answer

Bisphenol A-d16
Bisphenol A-d16 (CAS: 96210-87-6) is a polymerizable bisphenol derivative. It has a molecular weight of approximately 290.3 and exhibits good solubility in organic solvents. Chemically, it is highly reactive under certain conditions, particularly in the presence of acid catalysts. It crystallizes as white crystals and is stable under normal laboratory conditions.

About

CAS No 96210-87-6
English Name Bisphenol A-d16
Molecular Formula C15D16O2
Molecular Weight 244.39 g/mol
SMILES CC(C)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O
InChIKey IISBACLAFKSPIT-MAJJRYNQSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

How is Bisphenol A-d16 (CAS: 96210-87-6) typically synthesized?

Bisphenol A-d16 (CAS: 96210-87-6) is synthesized by the condensation of diphenol and 1,16-hexadecane...

Compound Q&A

What industries use Bisphenol A-d16 (CAS: 96210-87-6)?

Bisphenol A-d16 (CAS: 96210-87-6) is primarily used in the production of advanced polymers and compo...

Compound Q&A

What precautions should be taken when handling Bisphenol A-d16 (CAS: 96210-87-6)?

When handling Bisphenol A-d16 (CAS: 96210-87-6), it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...