Compound Q&A

How should 3'-Amino-2-biphenylcarboxylic acid (CAS: 67856-54-6) be stored?

Answer

3'-Amino-2-biphenylcarboxylic acid
3'-Amino-2-biphenylcarboxylic acid should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent degradation. Optimal storage conditions are between 2 and 8 degrees Celsius to maintain stability.

About

CAS No 67856-54-6
English Name 3'-Amino-2-biphenylcarboxylic acid
Molecular Formula C13H11NO2
Molecular Weight 213.24 g/mol
SMILES C1=CC=C(C(=C1)C2=CC(=CC=C2)N)C(=O)O
InChIKey UJLZGGUKWSTQJC-UHFFFAOYSA-N
Last Updated: 2026-03-07 11:14

Related Q&A

Compound Q&A

What is 3'-Amino-2-biphenylcarboxylic acid (CAS: 67856-54-6)?

3'-Amino-2-biphenylcarboxylic acid is an aromatic carboxylic acid derivative with a molecular formul...

Compound Q&A

What are the main uses of 3'-Amino-2-biphenylcarboxylic acid (CAS: 67856-54-6)?

3'-Amino-2-biphenylcarboxylic acid is primarily used in pharmaceuticals for the synthesis of drug in...

Compound Q&A

Is 3'-Amino-2-biphenylcarboxylic acid (CAS: 67856-54-6) safe?

3'-Amino-2-biphenylcarboxylic acid is generally safe when handled with appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...