Compound Q&A

Are there alternatives to 2-{[(4-Methylphenyl)sulfonyl]amino}benzoic acid (CAS: 6311-23-5) in synthesis?

Answer

2-{[(4-Methylphenyl)sulfonyl]amino}benzoic acid
Several alternatives can be used in the synthesis of 2-{[(4-Methylphenyl)sulfonyl]amino}benzoic acid (CAS: 6311-23-5), including the use of 4-methylbenzenesulfonyl chloride and various aminobenzoic acid derivatives. Other common reagents like p-toluenesulfonyl chloride and N-hydroxysuccinimide esters are also viable options depending on the specific reaction conditions and desired product.

About

CAS No 6311-23-5
English Name 2-{[(4-Methylphenyl)sulfonyl]amino}benzoic acid
Molecular Formula C14H13NO4S
Molecular Weight 291.33 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C(=O)O
InChIKey ADALGBTXGIISDM-UHFFFAOYSA-N
Last Updated: 2026-03-05 21:52

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-{[(4-Methylphenyl)sulfonyl]amino}benzoic acid (CAS: 6311-23-5)?

2-{[(4-Methylphenyl)sulfonyl]amino}benzoic acid (CAS: 6311-23-5) falls under various regulatory guid...

Compound Q&A

What is the market or research trend for 2-{[(4-Methylphenyl)sulfonyl]amino}benzoic acid (CAS: 6311-23-5)?

The market for 2-{[(4-Methylphenyl)sulfonyl]amino}benzoic acid (CAS: 6311-23-5) is growing due to it...

Compound Q&A

How should waste containing 2-{[(4-Methylphenyl)sulfonyl]amino}benzoic acid (CAS: 6311-23-5) be handled?

Waste containing 2-{[(4-Methylphenyl)sulfonyl]amino}benzoic acid (CAS: 6311-23-5) should be collecte...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...