Compound Q&A

Are there alternatives to Volvaltrate B in synthesis?

Answer

Volvaltrate B
There are several alternatives to Volvaltrate B in synthesis, including the use of isomers or analogs such as Volvaltrate A. Other substitute reagents like benzylamine or other amine derivatives are commonly used depending on the specific application and desired properties of the final product.

About

English Name Volvaltrate B
Molecular Formula C27H41ClO11
Molecular Weight 577.0670000000003 g/mol
SMILES CC(C)CC(=O)OC1C2C(CC(C2(CCl)O)OC(=O)C)(C(=CO1)COC(=O)C(C(C)C)OC(=O)CC(C)C)O
InChIKey OEVPPNBQSYOUCV-PXKJKYEHSA-N
Last Updated: 2026-03-05 17:17

Related Q&A

Compound Q&A

What regulatory guidelines apply to Volvaltrate B (CAS: 1181224-13-4)?

Regulatory guidelines for Volvaltrate B include the Classification and Labelling Inventory (CLP) und...

Compound Q&A

What is the market or research trend for Volvaltrate B?

The market for Volvaltrate B is currently stable, with increasing research interest in its applicati...

Compound Q&A

How should waste containing Volvaltrate B be handled?

Waste containing Volvaltrate B should be collected in appropriate containers and carefully labeled w...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...