Compound Q&A

How is Disodium 1,3,4-thiadiazole-2,5-bis(thiolate) (CAS: 55906-42-8) typically synthesized?

Answer

Disodium 1,3,4-thiadiazole-2,5-bis(thiolate)
Disodium 1,3,4-thiadiazole-2,5-bis(thiolate) (CAS: 55906-42-8) can be synthesized via a multi-step process involving the reaction of sodium thiomethoxide with 1,3,4-thiadiazole-2-thiol. The synthesis typically requires the use of a Lewis acid as a catalyst, leading to a high yield of the desired product.

About

CAS No 55906-42-8
English Name Disodium 1,3,4-thiadiazole-2,5-bis(thiolate)
Molecular Formula C2N2Na2S3
Molecular Weight 194.2 g/mol
SMILES C1(=NN=C(S1)[S-])[S-].[Na+].[Na+]
InChIKey YCVGBTRTVKMLSH-UHFFFAOYSA-L
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Disodium 1,3,4-thiadiazole-2,5-bis(thiolate) (CAS: 55906-42-8)?

Disodium 1,3,4-thiadiazole-2,5-bis(thiolate) (CAS: 55906-42-8) is a crystalline solid with a molecul...

Compound Q&A

What industries use Disodium 1,3,4-thiadiazole-2,5-bis(thiolate) (CAS: 55906-42-8)?

Disodium 1,3,4-thiadiazole-2,5-bis(thiolate) (CAS: 55906-42-8) is used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling Disodium 1,3,4-thiadiazole-2,5-bis(thiolate) (CAS: 55906-42-8)?

When handling Disodium 1,3,4-thiadiazole-2,5-bis(thiolate) (CAS: 55906-42-8), it is crucial to use a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...