Compound Q&A

What precautions should be taken when handling 4-Bromo-2-isopropyl-1-indanone (CAS: 892575-08-5)?

Answer

4-Bromo-2-isopropyl-1-indanone
When handling 4-Bromo-2-isopropyl-1-indanone (CAS: 892575-08-5), ensure to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Store it in a well-ventilated area, away from heat and direct sunlight. Use a fume hood during operations to minimize inhalation. In case of spill, clean up with care, following standard hazardous waste disposal procedures. Refer to the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

English Name 4-Bromo-2-isopropyl-1-indanone
Molecular Formula C12H13BrO
Molecular Weight 253.14 g/mol
SMILES CC(C)C1CC2=C(C1=O)C=CC=C2Br
InChIKey NBMQLWXVSZYABX-UHFFFAOYSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-2-isopropyl-1-indanone (CAS: 892575-08-5)?

4-Bromo-2-isopropyl-1-indanone (CAS: 892575-08-5) is a white crystalline solid with a molecular weig...

Compound Q&A

How is 4-Bromo-2-isopropyl-1-indanone (CAS: 892575-08-5) typically synthesized?

4-Bromo-2-isopropyl-1-indanone (CAS: 892575-08-5) is typically synthesized through the bromination o...

Compound Q&A

What industries use 4-Bromo-2-isopropyl-1-indanone (CAS: 892575-08-5)?

4-Bromo-2-isopropyl-1-indanone (CAS: 892575-08-5) is used in the pharmaceutical industry for the syn...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...